
CAS 1628638-80-1
:3,4-Dihydro-5-hydroxy-6-methoxy-1(2H)-isoquinolinone
Description:
3,4-Dihydro-5-hydroxy-6-methoxy-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system containing a nitrogen atom. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of hydroxyl and methoxy functional groups contributes to its potential reactivity and solubility in various solvents. The hydroxyl group can participate in hydrogen bonding, enhancing its interactions with biological targets, while the methoxy group may influence its lipophilicity and overall pharmacokinetic properties. Additionally, the dihydro form indicates that the compound may exist in a reduced state, which can affect its stability and reactivity. Overall, 3,4-Dihydro-5-hydroxy-6-methoxy-1(2H)-isoquinolinone is a compound with potential therapeutic applications, warranting further investigation into its biological effects and mechanisms of action.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-14-8-3-2-7-6(9(8)12)4-5-11-10(7)13/h2-3,12H,4-5H2,1H3,(H,11,13)
InChI key:InChIKey=KODROHMANIXNMX-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC=C1OC)C(=O)NCC2
Synonyms:- 3,4-Dihydro-5-hydroxy-6-methoxy-1(2H)-isoquinolinone
- 1(2H)-Isoquinolinone, 3,4-dihydro-5-hydroxy-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.