CAS 1629-95-4
:2-AMINO-5,5-DIMETHYL-5,6-DIHYDROBENZOTHIAZOL-7(4H)-ONE
Description:
2-Amino-5,5-dimethyl-5,6-dihydrobenzothiazol-7(4H)-one, with the CAS number 1629-95-4, is an organic compound that features a benzothiazole core, which is a bicyclic structure containing both a benzene ring and a thiazole ring. This compound is characterized by the presence of an amino group and two methyl groups at the 5-position of the thiazole ring, contributing to its unique chemical properties. It typically appears as a solid and is soluble in polar organic solvents. The compound exhibits potential biological activity, making it of interest in pharmaceutical research. Its structure allows for various chemical reactions, including nucleophilic substitutions and condensation reactions, which can be exploited in synthetic organic chemistry. Additionally, the presence of the thiazole moiety may impart specific electronic properties, influencing its reactivity and interaction with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H12N2OS
InChI:InChI=1/C9H12N2OS/c1-9(2)3-5-7(6(12)4-9)13-8(10)11-5/h3-4H2,1-2H3,(H2,10,11)
SMILES:CC1(C)Cc2c(C(=O)C1)sc(=N)[nH]2
Synonyms:- 1629-95-4
- 2-Amino-5,5-dimethyl-5,6-dihydro-1,3-benzothiazol-7(4H)-one
- 2-Amino-5,5-dimethyl-5,6-dihydro-4H-benzothiazol-7-one
- 7(4H)-Benzothiazolone, 2-amino-5,6-dihydro-5,5-dimethyl-
- T56 Bn Ds Fv& Tj Cz H1 H1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7(4H)-Benzothiazolone, 2-amino-5,6-dihydro-5,5-dimethyl-
CAS:Formula:C9H12N2OSPurity:97%Color and Shape:SolidMolecular weight:196.26942-Amino-5,5-dimethyl-5,6-dihydrobenzothiazol-7(4H)-one
CAS:2-Amino-5,5-dimethyl-5,6-dihydrobenzothiazol-7(4H)-onePurity:≥95%Molecular weight:196.27g/mol2-Amino-5,5-dimethyl-5,6-dihydro-4H-benzothiazol-7-one
CAS:Please enquire for more information about 2-Amino-5,5-dimethyl-5,6-dihydro-4H-benzothiazol-7-one including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H12N2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:196.27 g/mol2-Amino-5,5-dimethyl-5,6-dihydro-4H-benzothiazol-7-one
CAS:Formula:C9H12N2OSPurity:95%Color and Shape:Solid, PowderMolecular weight:196.272-Amino-5,5-dimethyl-5,6-dihydro-4h-benzothiazol-7-one
CAS:Controlled ProductApplications 2-Amino-5,5-dimethyl-5,6-dihydro-4h-benzothiazol-7-one
Formula:C9H12N2OSColor and Shape:NeatMolecular weight:196.27




