
CAS 162959-99-1
:1-(3-Thienyl)cyclopropanecarbonitrile
Description:
1-(3-Thienyl)cyclopropanecarbonitrile is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. The presence of the cyano group (–C≡N) enhances its polarity and can influence its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. The compound's reactivity can be attributed to the presence of both the nitrile and the cyclic structure, which may participate in various chemical reactions, including nucleophilic additions or cycloadditions. Additionally, the thienyl group may impart specific electronic properties, making it of interest in electronic applications or as a building block in more complex organic molecules. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C8H7NS
InChI:InChI=1S/C8H7NS/c9-6-8(2-3-8)7-1-4-10-5-7/h1,4-5H,2-3H2
InChI key:InChIKey=BQPOWBNNEAXARZ-UHFFFAOYSA-N
SMILES:C(#N)C1(CC1)C=2C=CSC2
Synonyms:- Cyclopropanecarbonitrile, 1-(3-thienyl)-
- 1-(Thiophen-3-yl)cyclopropane-1-carbonitrile
- 1-(Thiophen-3-yl)cyclopropanecarbonitrile
- 1-(3-Thienyl)cyclopropanecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.