CAS 162960-09-0
:Cyclopropanecarboxylic acid, 1-(2-furanyl)-
Description:
Cyclopropanecarboxylic acid, 1-(2-furanyl)- is an organic compound characterized by a cyclopropane ring attached to a carboxylic acid functional group and a furanyl substituent. The presence of the cyclopropane structure imparts unique strain and reactivity to the molecule, making it an interesting subject for synthetic chemistry. The furanyl group, derived from furan, contributes to the compound's aromatic properties and can influence its reactivity and interaction with other chemical species. This compound is likely to exhibit typical carboxylic acid characteristics, such as acidity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. Additionally, the presence of both the cyclopropane and furanyl groups may lead to distinctive physical properties, such as boiling and melting points, as well as specific reactivity patterns in organic reactions. Overall, cyclopropanecarboxylic acid, 1-(2-furanyl)- is a compound of interest in organic synthesis and medicinal chemistry due to its unique structural features.
Formula:C8H8O3
InChI:InChI=1S/C8H8O3/c9-7(10)8(3-4-8)6-2-1-5-11-6/h1-2,5H,3-4H2,(H,9,10)
InChI key:InChIKey=RAMRLSCOVVWKSG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C2=CC=CO2
Synonyms:- Cyclopropanecarboxylic acid, 1-(2-furanyl)-
- 1-(Furan-2-yl)cyclopropane-1-carboxylic acid
- 1-(Furan-2-yl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
