CAS 16297-09-9

2,3,5,6-Tetrafluoro-4-pyridinecarboxaldehyde

Description:

2,3,5,6-Tetrafluoro-4-pyridinecarboxaldehyde is a fluorinated heterocyclic compound characterized by the presence of a pyridine ring substituted with four fluorine atoms and an aldehyde functional group. The molecular structure features a pyridine core, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its unique chemical properties. The presence of multiple fluorine atoms enhances its reactivity and polarity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. The aldehyde group introduces reactivity typical of carbonyl compounds, allowing for further functionalization. This compound is typically a colorless to pale yellow liquid or solid, depending on the specific conditions, and is known for its stability under standard conditions. Its fluorinated nature may impart unique solubility characteristics, often making it soluble in organic solvents while being less soluble in water. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.

Formula: C₆HF₄NO

InChI: InChI=1S/C6HF4NO/c7-3-2(1-12)4(8)6(10)11-5(3)9/h1H

InChI key: InChIKey=ADFBSIFTMLQGNB-UHFFFAOYSA-N

SMILES: C(=O)C=1C(F)=C(F)N=C(F)C1F

Synonyms:

• 2,3,5,6-Tetrafluoro-4-pyridinecarboxaldehyde
• 4-Pyridinecarboxaldehyde, 2,3,5,6-tetrafluoro-
• 2,3,5,6-Tetrafluoropyridine-4-carbaldehyde
• Isonicotinaldehyde, tetrafluoro-

2,3,5,6-Tetrafluoropyridine-4-carboxaldehyde

CAS: 16297-09-9

2,3,5,6-Tetrafluoropyridine-4-carboxaldehyde

Purity: ≥95%

Molecular weight: 179.07g/mol

Ref: 54-PC502226

2,3,5,6-Tetrafluoropyridine-4-carbaldehyde

CAS: 16297-09-9

Please enquire for more information about 2,3,5,6-Tetrafluoropyridine-4-carbaldehyde including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆HF₄NO

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 179.07 g/mol

Ref: 3D-RAA29709