
CAS 16297-95-3
:3-Methyl-3H-diazirine-3-acetic acid
Description:
3-Methyl-3H-diazirine-3-acetic acid is a diazirine derivative characterized by its unique three-membered nitrogen-containing ring structure, which imparts distinctive reactivity, particularly in photochemistry. This compound features a methyl group and an acetic acid functional group, contributing to its solubility and potential biological activity. The diazirine moiety is known for its ability to undergo photolysis upon exposure to ultraviolet light, leading to the formation of highly reactive carbene species. This property makes 3-Methyl-3H-diazirine-3-acetic acid valuable in various applications, including chemical biology, where it can be used for labeling biomolecules or studying protein interactions. The compound's stability under ambient conditions, along with its reactivity upon irradiation, allows for versatile experimental designs in research settings. Additionally, its structural characteristics suggest potential interactions with biological systems, making it a subject of interest in medicinal chemistry and drug development. Overall, 3-Methyl-3H-diazirine-3-acetic acid is a significant compound in the realm of synthetic and applied chemistry.
Formula:C4H6N2O2
InChI:InChI=1S/C4H6N2O2/c1-4(5-6-4)2-3(7)8/h2H2,1H3,(H,7,8)
InChI key:InChIKey=IZMJXSJIJTWBBX-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1(C)N=N1
Synonyms:- 3H-Diazirine-3-acetic acid, 3-methyl-
- (3-Methyl-3H-diazirin-3-yl)-acetic acid
- 3-Methyl-3H-diazirine-3-acetic acid
- 2-(3-Methyl-3H-diazirin-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.