CAS 162971-77-9

2-hydroxy-3-(2-methylallyl)benzaldehyde

Description:

2-Hydroxy-3-(2-methylallyl)benzaldehyde, with the CAS number 162971-77-9, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a hydroxyl group. This compound features a hydroxyl (-OH) group at the ortho position relative to the aldehyde (-CHO) group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2-methylallyl substituent enhances its chemical properties, making it a versatile intermediate in the synthesis of various organic compounds. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The compound is soluble in organic solvents and may exhibit moderate solubility in water due to the hydroxyl group. Its reactivity can be attributed to the electrophilic nature of the aldehyde group and the potential for hydrogen bonding from the hydroxyl group. As with many organic compounds, it should be handled with care, considering safety protocols to avoid exposure or inhalation.

Formula: C₁₁H₁₂O₂

InChI: InChI=1/C11H12O2/c1-8(2)6-9-4-3-5-10(7-12)11(9)13/h3-5,7,13H,1,6H2,2H3

SMILES: C=C(C)Cc1cccc(C=O)c1O