CAS 1629858-78-1
:(3R,4R)-4-Methyl-3-(methylamino)-β-oxo-1-piperidinepropanenitrile
Description:
(3R,4R)-4-Methyl-3-(methylamino)-β-oxo-1-piperidinepropanenitrile is a chemical compound characterized by its specific stereochemistry and functional groups. The presence of a piperidine ring indicates that it is a cyclic amine, which contributes to its potential biological activity. The compound features a β-oxo group, suggesting it may participate in various chemical reactions, including condensation and nucleophilic addition. The methylamino group enhances its basicity and may influence its interaction with biological targets. Additionally, the nitrile functional group can impart unique reactivity and solubility properties. The stereochemistry, denoted by the (3R,4R) configuration, is crucial for determining the compound's three-dimensional shape, which can significantly affect its pharmacological properties and interactions with enzymes or receptors. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that suggest potential bioactivity.
Formula:C10H17N3O
InChI:InChI=1S/C10H17N3O/c1-8-4-6-13(7-9(8)12-2)10(14)3-5-11/h8-9,12H,3-4,6-7H2,1-2H3/t8-,9+/m1/s1
InChI key:InChIKey=KEKLWZJZCPXANS-BDAKNGLRSA-N
SMILES:C(CC#N)(=O)N1C[C@H](NC)[C@H](C)CC1
Synonyms:- (3R,4R)-4-Methyl-3-(methylamino)-β-oxo-1-piperidinepropanenitrile
- 1-Piperidinepropanenitrile, 4-methyl-3-(methylamino)-β-oxo-, (3R,4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tofacitinib Impurity 118 HCl
CAS:Formula:C10H17N3O·HClColor and Shape:White To Off-White SolidMolecular weight:195.27 36.46(3R,4R)-4-Methyl-3-(methylamino)-β-oxo-1-piperidinepropanenitrile
CAS:Controlled ProductApplications (3R,4R)-4-Methyl-3-(methylamino)-β-oxo-1-piperidinepropanenitrile is an intermediate used in the preparation of Tofacitinib.
References Wang, H., et al.: From Faming Zhuanli Shenqing (2014), CN 104059016 A 20140924Formula:C10H17N3OColor and Shape:NeatMolecular weight:195.262

