
CAS 1630096-67-1
:1-Propanesulfonamide, N-(cyclobutylmethyl)-, hydrochloride (1:1)
Description:
1-Propanesulfonamide, N-(cyclobutylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclobutylmethyl group attached to the nitrogen of the sulfonamide, contributing to its unique structural and potentially pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The presence of the sulfonamide moiety suggests potential interactions with biological systems, particularly in the inhibition of certain enzymes. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would require further investigation. Additionally, its stability, solubility, and reactivity can be influenced by the presence of the hydrochloride group, making it a subject of interest in drug formulation and development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C8H17NO2S·ClH
InChI:InChI=1S/C8H17NO2S.ClH/c1-2-6-12(10,11)9-7-8-4-3-5-8;/h8-9H,2-7H2,1H3;1H
InChI key:InChIKey=MPWHKMYWAFEZQN-UHFFFAOYSA-N
SMILES:C(NS(CCC)(=O)=O)C1CCC1.Cl
Synonyms:- 1-Propanesulfonamide, N-(cyclobutylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.