
CAS 1630096-69-3
:Ethanesulfonamide, 2-amino-N-(cyclopropylmethyl)-, hydrochloride (1:1)
Description:
Ethanesulfonamide, 2-amino-N-(cyclopropylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclopropylmethyl group attached to an amino group, contributing to its unique structural and chemical properties. The hydrochloride form indicates that it is a salt, which typically enhances its solubility in water, making it suitable for various applications, including pharmaceutical formulations. The presence of the sulfonamide group suggests potential biological activity, particularly in the realm of medicinal chemistry, where such compounds are often explored for their therapeutic effects. Additionally, the compound's molecular structure may influence its pharmacokinetics and pharmacodynamics, affecting how it interacts with biological systems. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure. Overall, this compound represents a specific class of sulfonamide derivatives with potential applications in drug development and research.
Formula:C6H14N2O2S·ClH
InChI:InChI=1S/C6H14N2O2S.ClH/c7-3-4-11(9,10)8-5-6-1-2-6;/h6,8H,1-5,7H2;1H
InChI key:InChIKey=HBFQHWRYVHJAJJ-UHFFFAOYSA-N
SMILES:C(NS(CCN)(=O)=O)C1CC1.Cl
Synonyms:- Ethanesulfonamide, 2-amino-N-(cyclopropylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.