CAS 1630096-71-7

Pyrano[3,4-c]pyrazole-3-carboxylic acid, 1,4,5,7-tetrahydro-, ethyl ester

Description:

Pyrano[3,4-c]pyrazole-3-carboxylic acid, 1,4,5,7-tetrahydro-, ethyl ester is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyran and a pyrazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity, making it of interest in medicinal chemistry. The presence of the ethyl ester functional group suggests that it may have enhanced solubility and bioavailability compared to its acid form. The tetrahydro configuration indicates that the compound is saturated, which can influence its reactivity and stability. Additionally, the carboxylic acid functionality may participate in various chemical reactions, such as esterification or amidation, and can also play a role in hydrogen bonding interactions. Overall, this compound's structural features may contribute to its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Further studies would be necessary to elucidate its specific properties and biological activities.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-2-14-9(12)8-6-3-4-13-5-7(6)10-11-8/h2-5H2,1H3,(H,10,11)

InChI key: InChIKey=HIOXBJUAJSRZGE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(NN1)COCC2

Synonyms:

• Ethyl 1,4,5,7-tetrahydropyrano[3,4-c]pyrazole-3-carboxylate
• Pyrano[3,4-c]pyrazole-3-carboxylic acid, 1,4,5,7-tetrahydro-, ethyl ester
• Ethyl 1H,4H,5H,7H-pyrano-[3,4-c]pyrazole-3-carboxylate

ethyl 1H,4H,5H,7H-pyrano[3,4-c]pyrazole-3-carboxylate

CAS: 1630096-71-7

Formula: C₉H₁₂N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.2032

Ref: IN-DA00IZIM

Ethyl 1,4,5,7-tetrahydropyrano[3,4-c]pyrazole-3-carboxylate

CAS: 1630096-71-7

Ethyl 1,4,5,7-tetrahydropyrano[3,4-c]pyrazole-3-carboxylate

Purity: 97%

Molecular weight: 196.21g/mol

Ref: 54-OR1056909

Ethyl 2H,4H,5H,7H-pyrano[3,4-c]pyrazole-3-carboxylate

CAS: 1630096-71-7

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-FQC09671