CAS 16303-23-4

2,4,6-Tri(morpholino)-1,3,5-triazine

Description:

2,4,6-Tri(morpholino)-1,3,5-triazine, with the CAS number 16303-23-4, is a chemical compound characterized by its triazine ring structure, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features three morpholino groups, which are derived from morpholine, a cyclic amine known for its stability and solubility in water. The presence of these morpholino substituents enhances the compound's solubility and may impart unique properties, such as increased reactivity or specific interactions with biological systems. 2,4,6-Tri(morpholino)-1,3,5-triazine is often studied for its potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Its structure suggests potential for hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, this compound exemplifies the versatility of triazine derivatives in chemical research and application.

Formula: C₁₅H₂₄N₆O₃

InChI: InChI=1S/C15H24N6O3/c1-7-22-8-2-19(1)13-16-14(20-3-9-23-10-4-20)18-15(17-13)21-5-11-24-12-6-21/h1-12H2

InChI key: InChIKey=GHKBOCAECRMABJ-UHFFFAOYSA-N

SMILES: C=1(N=C(N=C(N1)N2CCOCC2)N3CCOCC3)N4CCOCC4

Synonyms:

• s-Triazine, 2,4,6-trimorpholino-
• 2,4,6-Tris(morpholino)-1,3,5-triazine
• 1,3,5-Triazine, 2,4,6-tri-4-morpholinyl-
• 2,4,6-Tri-4-morpholinyl-1,3,5-triazine
• 2,4,6-Tri(morpholino)-1,3,5-triazine

tris(morpholin-4-yl)-1,3,5-triazine

CAS: 16303-23-4

Formula: C₁₅H₂₄N₆O₃

Molecular weight: 336.3895

Ref: IN-DA001TMP

Tris(morpholin-4-yl)-1,3,5-triazine

CAS: 16303-23-4

Tris(morpholin-4-yl)-1,3,5-triazine is a morpholine that has been used as a solvent. It is also used for the synthesis of ligands or as an acceptor in crystallographic studies. Tris(morpholin-4-yl)-1,3,5-triazine has a wide range of properties and can be used to adsorb different substances due to its interaction with them. This compound has been shown to have strong interactions with hydrochloric acid and isotherms are often used to describe these interactions.

Formula: C₁₅H₂₄N₆O₃

Purity: Min. 95%

Molecular weight: 336.39 g/mol

Ref: 3D-RAA30323