
CAS 163038-04-8
:3-Hydroxy-5-methyl-2-hexanone
Description:
3-Hydroxy-5-methyl-2-hexanone, with the CAS number 163038-04-8, is an organic compound characterized by its ketone functional group and hydroxyl group. It features a six-carbon chain with a methyl group at the fifth position and a hydroxyl group at the third position, contributing to its classification as a hydroxy ketone. This compound is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. Its molecular structure allows for potential applications in organic synthesis and as an intermediate in the production of various chemicals. The presence of both a hydroxyl and a ketone group can influence its reactivity, making it a versatile compound in chemical reactions, including oxidation and reduction processes. Additionally, it may exhibit properties such as being hygroscopic and having moderate volatility. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14O2
InChI:InChI=1S/C7H14O2/c1-5(2)4-7(9)6(3)8/h5,7,9H,4H2,1-3H3
InChI key:InChIKey=LZDPYURTPRCDJG-UHFFFAOYSA-N
SMILES:C(CC(C)C)(C(C)=O)O
Synonyms:- 3-Hydroxy-5-methyl-2-hexanone
- 3-Hydroxy-5-methylhexan-2-one
- 2-Hexanone, 3-hydroxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.