CAS 1630763-35-7

2(3H)-Furanone, dihydro-3-(1-piperazinyl)-, hydrochloride (1:2)

Description:

2(3H)-Furanone, dihydro-3-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its furanone core structure, which is a five-membered lactone ring containing an oxygen atom. The presence of a dihydro group indicates that the compound has undergone hydrogenation, resulting in a saturated derivative. The piperazine moiety suggests that the compound possesses basic properties, as piperazine is a cyclic amine known for its ability to form salts with acids, such as hydrochloric acid in this case. This hydrochloride salt form enhances the solubility of the compound in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit biological activity due to the presence of both the furanone and piperazine structures, which are often associated with diverse pharmacological effects. Overall, its unique structural features contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₈H₁₄N₂O₂·2ClH

InChI: InChI=1S/C8H14N2O2.2ClH/c11-8-7(1-6-12-8)10-4-2-9-3-5-10;;/h7,9H,1-6H2;2*1H

InChI key: InChIKey=YJKGQCYIYRLULZ-UHFFFAOYSA-N

SMILES: O=C1C(CCO1)N2CCNCC2.Cl

Synonyms:

• 2(3H)-Furanone, dihydro-3-(1-piperazinyl)-, hydrochloride (1:2)

3-(Piperazin-1-yl)oxolan-2-one dihydrochloride

CAS: 1630763-35-7

Versatile small molecule scaffold

Formula: C₈H₁₆Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 243.13 g/mol

Ref: 3D-FQC76335