CAS 1630763-37-9

4-Chloro-1-ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid

Description:

4-Chloro-1-ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 4-position, an ethyl group at the 1-position, and a phenyl group at the 3-position of the pyrazole ring, along with a carboxylic acid functional group at the 5-position. The presence of the carboxylic acid group contributes to its acidity and potential reactivity in various chemical reactions. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic phenyl group may enhance its hydrophobic characteristics. Additionally, the chloro substituent can influence the compound's reactivity and biological activity. Overall, this compound may be of interest in pharmaceutical research and development, particularly in the synthesis of novel pyrazole derivatives with potential therapeutic applications.

Formula: C₁₂H₁₁ClN₂O₂

InChI: InChI=1S/C12H11ClN2O2/c1-2-15-11(12(16)17)9(13)10(14-15)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,16,17)

InChI key: InChIKey=XBFQYOZVWQEDCR-UHFFFAOYSA-N

SMILES: ClC=1C(=NN(CC)C1C(O)=O)C2=CC=CC=C2

Synonyms:

• 4-Chloro-1-ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid
• 1H-Pyrazole-5-carboxylic acid, 4-chloro-1-ethyl-3-phenyl-