CymitQuimica logo

CAS 1630763-90-4

:

Isoindolo[2,1-a]quinazoline-6(5H)-butanoic acid, 6a,11-dihydro-9,10-dimethoxy-5,11-dioxo-

Description:
Isoindolo[2,1-a]quinazoline-6(5H)-butanoic acid, 6a,11-dihydro-9,10-dimethoxy-5,11-dioxo- is a complex organic compound characterized by its unique bicyclic structure, which incorporates both isoindole and quinazoline moieties. This compound features a butanoic acid functional group, contributing to its potential acidity and reactivity. The presence of methoxy groups at the 9 and 10 positions enhances its solubility and may influence its biological activity. The dioxo functionality indicates the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural complexity suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, stability, and synthesis are necessary to fully understand its potential uses and characteristics.
Formula:C21H20N2O6
InChI:InChI=1S/C21H20N2O6/c1-28-15-10-9-13-17(18(15)29-2)21(27)23-14-7-4-3-6-12(14)20(26)22(19(13)23)11-5-8-16(24)25/h3-4,6-7,9-10,19H,5,8,11H2,1-2H3,(H,24,25)
InChI key:InChIKey=ZVMXAIYIRBWSAF-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1C2N(C=3C(C1=O)=CC=CC3)C(=O)C=4C2=CC=C(OC)C4OC
Synonyms:
  • 6a,11-Dihydro-9,10-dimethoxy-5,11-dioxoisoindolo[2,1-a]quinazoline-6(5H)-butanoic acid
  • Isoindolo[2,1-a]quinazoline-6(5H)-butanoic acid, 6a,11-dihydro-9,10-dimethoxy-5,11-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.