CAS 163082-41-5
:2,2,2-trifluoro-1-phenanthren-9-ylethanone
Description:
2,2,2-Trifluoro-1-phenanthren-9-ylethanone is an organic compound characterized by the presence of a phenanthrene moiety and a trifluoroacetyl group. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. The presence of the phenanthrene structure contributes to its aromatic characteristics, which can affect its electronic properties and stability. The trifluoromethyl group is known for its electron-withdrawing effects, which can enhance the acidity of adjacent hydrogen atoms and influence the compound's reactivity in nucleophilic substitution reactions. Additionally, the compound may exhibit interesting photophysical properties due to the conjugated system of the phenanthrene ring, making it potentially useful in applications such as organic electronics or as a fluorescent probe. Overall, 2,2,2-trifluoro-1-phenanthren-9-ylethanone is a compound of interest in both synthetic and applied chemistry due to its unique structural features and potential applications.
Formula:C16H9F3O
InChI:InChI=1/C16H9F3O/c17-16(18,19)15(20)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H
SMILES:c1ccc2c(c1)cc(c1ccccc21)C(=O)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
