CAS 163083-48-5
:6-METHYL-2-NITRO-3-PYRIDYL TRIFLUOROMETHANESULFONATE
Description:
6-Methyl-2-nitro-3-pyridyl trifluoromethanesulfonate, with the CAS number 163083-48-5, is a chemical compound characterized by its pyridine ring structure, which is substituted with a methyl group and a nitro group at specific positions. The trifluoromethanesulfonate moiety contributes to its reactivity, making it a useful electrophile in various organic synthesis reactions. This compound is typically used in the field of medicinal chemistry and agrochemicals, where it may serve as an intermediate in the synthesis of biologically active molecules. Its properties include being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the nitro group suggests that it may exhibit some degree of polarity and can participate in electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may be toxic and reactive. Overall, 6-Methyl-2-nitro-3-pyridyl trifluoromethanesulfonate is a valuable compound in synthetic organic chemistry, particularly for the development of pharmaceuticals and agrochemicals.
Formula:C7H5F3N2O5S
InChI:InChI=1/C7H5F3N2O5S/c1-4-2-3-5(6(11-4)12(13)14)17-18(15,16)7(8,9)10/h2-3H,1H3
SMILES:Cc1ccc(c(n1)N(=O)=O)OS(=O)(=O)C(F)(F)F
Synonyms:- 6-Methyl-2-Nitropyridin-3-Yl Trifluoromethanesulfonate
- 6-Methyl-2-nitro-3-pyridyltrifluoroMethylsulfonate
- 6-METHYL-2-NITRO-3-PYRIDYL TRIFLUOROMET&
- Methanesulfonic acid, 1,1,1-trifluoro-, 6-methyl-2-nitro-3-pyridinyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.