CAS 1630906-47-6

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile

Description:

5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. The presence of a chlorine atom at the 5-position and a cyano group at the 2-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The cyano group can participate in nucleophilic reactions, while the chlorine atom may influence the compound's lipophilicity and interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by the electronic properties of the heteroatoms in the rings. Overall, 5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile is a valuable compound for research in organic synthesis and pharmacology.

Formula: C₈H₄ClN₃

InChI: InChI=1S/C8H4ClN3/c9-8-2-1-6-7(12-8)3-5(4-10)11-6/h1-3,11H

InChI key: InChIKey=CYULQIWXOBZJIP-UHFFFAOYSA-N

SMILES: C(#N)C=1NC=2C(C1)=NC(Cl)=CC2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-2-carbonitrile, 5-chloro-
• 5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile

5-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE-2-CARBONITRILE

CAS: 1630906-47-6

Formula: C₈H₄ClN₃

Purity: 97%

Molecular weight: 177.59

Ref: 10-F504667