CAS 1630907-16-2

Piperidine, 4-(difluoromethoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(difluoromethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a difluoromethoxy group at the 4-position of the piperidine ring introduces unique electronic and steric properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and chemical synthesis. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a specific class of piperidine derivatives that may have significant implications in research and industry.

Formula: C₆H₁₁F₂NO·ClH

InChI: InChI=1S/C6H11F2NO.ClH/c7-6(8)10-5-1-3-9-4-2-5;/h5-6,9H,1-4H2;1H

InChI key: InChIKey=OELQMMRGXWRCRJ-UHFFFAOYSA-N

SMILES: O(C(F)F)C1CCNCC1.Cl

Synonyms:

• Piperidine, 4-(difluoromethoxy)-, hydrochloride (1:1)

4-(Difluoromethoxy)piperidine hydrochloride

CAS: 1630907-16-2

Formula: C₆H₁₂ClF₂NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.6154

Ref: IN-DA00IL3J

4-(DIFLUOROMETHOXY)PIPERIDINE HCL

CAS: 1630907-16-2

Formula: C₆H₁₂ClF₂NO

Purity: 97%

Molecular weight: 187.61

Ref: 10-F504211