CAS 1630907-35-5: Phenylmethyl 3-(methylamino)-1-azetidinecarboxylate
Description:Phenylmethyl 3-(methylamino)-1-azetidinecarboxylate, identified by its CAS number 1630907-35-5, is a chemical compound that features a unique azetidine ring structure, which is a four-membered saturated heterocyclic ring containing one nitrogen atom. This compound is characterized by the presence of a phenylmethyl group and a methylamino substituent, contributing to its potential biological activity. The azetidinecarboxylate moiety suggests that it may exhibit properties typical of carboxylic acid derivatives, such as reactivity in esterification and potential interactions in biological systems. The presence of the methylamino group indicates possible basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents, although specific biological activities and applications would require further investigation.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-13-11-7-14(8-11)12(15)16-9-10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3
InChI key:InChIKey=YKLRQIQMOPHXKS-UHFFFAOYSA-N
SMILES:O=C(OCC=1C=CC=CC1)N2CC(NC)C2
- Synonyms:
- 1-Azetidinecarboxylic acid, 3-(methylamino)-, phenylmethyl ester
- Phenylmethyl 3-(methylamino)-1-azetidinecarboxylate
Benzyl 3-(methylamino)azetidine-1-carboxylate
Ref: IN-DA003A8L
| Undefined size | To inquire |
Ref: 54-OR1021970
| 1g | 616.00 € | ||
| 5g | 1,708.00 € | ||
| 25g | 2,941.00 € | ||
| 250mg | 264.00 € |
BENZYL 3-(METHYLAMINO)AZETIDINE-1-CARBOXYLATE
Ref: 10-F501872
| 1g | To inquire | ||
| 5g | To inquire | ||
| 10g | To inquire |
benzyl 3-(methylamino)azetidine-1-carboxylate
Ref: 3D-FQC90735
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
