CAS 1631-58-9
:Nereistoxin
Description:
Nereistoxin, with the CAS number 1631-58-9, is a potent neurotoxin originally derived from marine organisms, particularly certain species of marine worms. It is classified as a polyether and is known for its complex structure, which includes multiple cyclic and linear components. Nereistoxin acts primarily as a neurotoxic agent by interfering with the normal functioning of sodium channels in nerve cells, leading to paralysis and potentially fatal outcomes in affected organisms. This compound exhibits high toxicity to various aquatic species and has been studied for its potential applications in pest control, particularly in agriculture, due to its selective toxicity. Additionally, its unique mechanism of action has garnered interest in pharmacological research, although its use is limited by safety concerns. Nereistoxin is typically handled with caution in laboratory settings, and its environmental impact is a subject of ongoing research, particularly in relation to its effects on non-target species in marine ecosystems.
Formula:C5H11NS2
InChI:InChI=1S/C5H11NS2/c1-6(2)5-3-7-8-4-5/h5H,3-4H2,1-2H3
InChI key:InChIKey=DSOOGBGKEWZRIH-UHFFFAOYSA-N
SMILES:N(C)(C)C1CSSC1
Synonyms:- 1,2-Dithiolan-4-amine, N,N-dimethyl-
- N,N-Dimethyl-1,2-Dithiolan-4-Amine
- Nereistoxine
- Nereistoxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nereistoxin
CAS:Nereistoxin is a neurotoxin from Lumbriconereis heteropoda that blocks nicotinic acetylcholine receptors.Formula:C5H11NS2Color and Shape:SolidMolecular weight:149.28
