CymitQuimica logo

CAS 16310-65-9

:

3,4-Dihydrobenzo[ghi]perylene

Description:
3,4-Dihydrobenzo[ghi]perylene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of multiple aromatic rings. This compound is typically a colorless to pale yellow solid at room temperature and is known for its high stability and low reactivity due to the resonance stabilization provided by its extensive conjugated system. It is insoluble in water but soluble in organic solvents such as benzene and toluene. 3,4-Dihydrobenzo[ghi]perylene is of interest in various fields, including materials science and environmental chemistry, due to its potential applications in organic electronics and as a model compound for studying the behavior of PAHs in the environment. Additionally, like many PAHs, it may pose environmental and health risks, as some derivatives are known to be carcinogenic. Its synthesis typically involves complex organic reactions, and it can be found in certain fossil fuels and as a byproduct of combustion processes.
Formula:C22H14
InChI:InChI=1S/C22H14/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-7,9,11-12H,8,10H2
InChI key:InChIKey=STUHEQLGYKSSCX-UHFFFAOYSA-N
SMILES:C12=C3C=4C=5C=6C1=C(CCC2=CC=C3C=CC4C=CC5)C=CC6
Synonyms:
  • Benzo[ghi]perylene, 3,4-dihydro-
  • 1,2-dihydrobenzo[ghi]perylene
  • 3,4-Dihydrobenzo[ghi]perylene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.