CAS 16310-92-2
:DATISCIN
Description:
Datiscin, with the CAS number 16310-92-2, is a chemical compound derived from the plant Datisca glomerata, commonly known for its medicinal properties. It is classified as a natural alkaloid and exhibits a complex molecular structure. Datiscin is known for its potential pharmacological activities, including anti-inflammatory and analgesic effects, which have garnered interest in medicinal chemistry and pharmacology. The compound's mechanism of action may involve modulation of various biochemical pathways, although detailed studies are still ongoing to fully elucidate its effects. Datiscin is typically studied in the context of traditional medicine and its potential applications in modern therapeutics. As with many natural products, the extraction and purification processes can influence its bioactivity and stability. Safety and toxicity profiles are essential considerations in its application, necessitating thorough research to ensure its efficacy and safety in potential therapeutic uses. Overall, datiscin represents a fascinating area of study within natural product chemistry and pharmacognosy.
Formula:C27H30O15
InChI:InChI=1/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-10(28)7-14(16)40-24(25)11-4-2-3-5-12(11)29/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15-,17-,18-,20+,21+,22+,23-,26+,27+/m1/s1
Synonyms:- Datiscetin-3-O-Rutinoside
- Datiscoside
- Datistin
- Daticoside
- DATISCIN
- DATISCIN(RG)
- 4H-1-Benzopyran-4-one, 3-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5,7-dihydroxy-2-(2-hydroxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Datiscin
CAS:Datiscin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C27H30O15Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:594.53Datiscin
CAS:<p>Datiscin is a natural product for research related to life sciences. The catalog number is TN3772 and the CAS number is 16310-92-2.</p>Formula:C27H30O15Purity:98%Color and Shape:SolidMolecular weight:594.52Datiscin
CAS:<p>Datiscin is a flavonoid glycoside, which is a type of naturally occurring compound found in plants. It is derived from various botanical sources, notably within the Datisca genus. These compounds are characterized by a flavonoid core structure bonded to sugar moieties. The mode of action of Datiscin primarily involves its interaction with free radicals and reactive oxygen species, suggesting potential antioxidative properties. This mechanism can help mitigate oxidative stress within biological systems.</p>Formula:C27H30O15Purity:Min. 95%Molecular weight:594.52 g/mol


