CAS 163105-89-3
:2-Methoxy-5-pyridineboronic acid
Description:
2-Methoxy-5-pyridineboronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with a methoxy group and a boronic acid functional group. Its molecular structure features a five-membered aromatic ring, which contributes to its stability and reactivity. The methoxy group enhances its solubility in organic solvents and can participate in various chemical reactions, while the boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound is often utilized in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, its boronic acid functionality allows it to act as a ligand in coordination chemistry and as a potential building block in the development of pharmaceuticals. Overall, 2-Methoxy-5-pyridineboronic acid is valued for its versatility in synthetic applications and its role in the development of complex organic molecules.
Formula:C6H8BNO3
InChI:InChI=1/C6H8BNO3/c1-11-6-3-2-5(4-8-6)7(9)10/h2-4,9-10H,1H3
SMILES:COc1ccc(cn1)B(O)O
Synonyms:- 6-Methoxypyridine-3-boronic acid
- 4-Methoxy-3-Pyridinylboronic Acid
- 2-Methoxy-5-pyridylboronic acid
- Boronic acid, B-(6-methoxy-3-pyridinyl)-
- (6-Methoxy-3-Pyridyl)Boronic Acid
- 2-Methoxypyridine-5-boronic acid
- 6-Methoxypyridine-3-boronicacid
- 6-Methoxypyridin-3-Ylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Methoxypyridine-5-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H8BNO3Purity:97.0 to 113.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:152.942-Methoxypyridine-5-boronic acid, 95%
CAS:2-Methoxypyridine-5-boronic acid is used in cosmetics, coatings candles. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU
Formula:C6H8BNO3Purity:95%Color and Shape:White, PowderMolecular weight:152.94Boronic acid, B-(6-methoxy-3-pyridinyl)-
CAS:Formula:C6H8BNO3Purity:95%Color and Shape:SolidMolecular weight:152.94366-Methoxypyridine-3-boronic acid
CAS:6-Methoxypyridine-3-boronic acidFormula:C6H8BNO3Purity:97%Color and Shape: white solidMolecular weight:152.94g/mol2-Methoxypyridine-5-Boronic Acid extrapure, 98%
CAS:Formula:C6H8BNO3Purity:min. 98%Color and Shape:White, Crystalline powderMolecular weight:1532-Methoxy-5-pyridineboronic acid
CAS:Formula:C6H8BNO3Purity:95%Color and Shape:SolidMolecular weight:152.94







