CAS 163119-30-0
:2-[[[3-Methyl-1-oxido-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole
Description:
2-[[[3-Methyl-1-oxido-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core, a pyridine ring, and a trifluoroethoxy group. The presence of the thioether linkage and the oxido group contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties such as moderate to high lipophilicity due to the trifluoroethoxy substituent, which can influence its solubility and permeability in biological systems. Additionally, the methyl and oxido groups may enhance its electron-donating or withdrawing characteristics, affecting its interaction with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may act as a ligand or inhibitor in various biochemical pathways. However, specific biological activities, toxicity, and environmental impact would require further investigation through experimental studies.
Formula:C16H14F3N3O2S
InChI:InChI=1S/C16H14F3N3O2S/c1-10-13(22(23)7-6-14(10)24-9-16(17,18)19)8-25-15-20-11-4-2-3-5-12(11)21-15/h2-7H,8-9H2,1H3,(H,20,21)
InChI key:InChIKey=LGJKGASGASPHLH-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OCC(F)(F)F)=CC=N1=O)C=2NC=3C(N2)=CC=CC3
Synonyms:- 2-[[[3-Methyl-1-oxido-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole
- 1H-Benzimidazole, 2-[[[3-methyl-1-oxido-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-
- 2-[[3-Methyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium-2-yl]methylsulfanyl]-1H-benzimidazole
- 2-[[[4-(2,2,2-Trifluoroethoxy)-3-methyl-1-oxopyridin-2-yl]methyl]sulfanyl]-1H-benzimidazole
- 1H-Benzimidazole, 2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-, N-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Lansoprazole Pyridine N-Oxide
CAS:Formula:C16H14F3N3O2SColor and Shape:White To Off-White SolidMolecular weight:369.36Lansoprazole Sulfide N-Oxide
CAS:Controlled ProductFormula:C16H14F3N3O2SColor and Shape:NeatMolecular weight:369.36Lansoprazole Sulfide N-Oxide
CAS:Applications Used in the preparation of Lansoprazole and its metabolite and impurities.
References Reddy, G. et al.; Synthetic Commun. 38, 3477 (2008)Formula:C16H14F3N3O2SColor and Shape:Off White SolidMolecular weight:369.36



