CAS 16315-07-4
:1-methoxy-2,3-dinitrobenzene
Description:
1-Methoxy-2,3-dinitrobenzene, with the CAS number 16315-07-4, is an organic compound characterized by its aromatic structure featuring a methoxy group (-OCH3) and two nitro groups (-NO2) attached to a benzene ring. This compound typically appears as a yellow crystalline solid and is known for its relatively high stability under standard conditions. The presence of the nitro groups contributes to its electron-withdrawing properties, which can influence its reactivity and solubility in various solvents. It is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or other chemical compounds. Due to the presence of nitro groups, it may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Additionally, 1-methoxy-2,3-dinitrobenzene may have specific environmental and health considerations, making it important to follow safety guidelines when working with this substance.
Formula:C7H6N2O5
InChI:InChI=1/C7H6N2O5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3
SMILES:COc1cccc(c1N(=O)=O)N(=O)=O
Synonyms:- .alpha.-Dinitroanisole
- 2,3-Dinitrophenyl methyl ether
- Benzene, 1-Methoxy-2,3-Dinitro-
- Dinitroanisole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
