CAS 1632-19-5
:Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate
Description:
Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate, identified by its CAS number 1632-19-5, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two hydroxyl (-OH) groups at the 3 and 4 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of two carboxylate groups (-COOCH3) at the 2 and 5 positions indicates that it is a diester, which can influence its acidity and ability to participate in various chemical reactions. Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate is often studied for its potential applications in organic synthesis and medicinal chemistry, particularly due to its structural similarity to biologically relevant molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, this compound is of interest in both academic research and industrial applications due to its unique structural features and functional groups.
Formula:C8H9NO6
InChI:InChI=1/C8H9NO6/c1-3(10)15-7-6(12)5(11)4(9-7)8(13)14-2/h9,11-12H,1-2H3
SMILES:CC(=O)Oc1c(c(c(C(=O)OC)[nH]1)O)O
Synonyms:- 2,5-Bis[Hydroxy(Methoxy)Methylidene]Pyrrolidine-3,4-Dione
- methyl 5-acetoxy-3,4-dihydroxy-1H-pyrrole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9NO6Purity:97%Molecular weight:215.16Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate
CAS:Formula:C8H9NO6Purity:98%Color and Shape:SolidMolecular weight:215.1602Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate
CAS:Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylatePurity:98%Molecular weight:215.16g/molDimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate
CAS:Purity:98%+(HPLC);RGColor and Shape:SolidMolecular weight:215.1609955



