CymitQuimica logo

CAS 1632-49-1

:

3,4-Diphenyl-1H-pyrrole-2,5-dicarboxylic acid

Description:
3,4-Diphenyl-1H-pyrrole-2,5-dicarboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two phenyl groups attached to the pyrrole ring at the 3 and 4 positions, contributing to its aromatic character and potentially influencing its electronic properties. The presence of two carboxylic acid groups at the 2 and 5 positions enhances its acidity and solubility in polar solvents, making it useful in various chemical applications. The compound is typically a solid at room temperature and may exhibit crystalline properties. Its structure allows for potential interactions in biological systems, and it may serve as a precursor or intermediate in organic synthesis. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including esterification and amidation. Overall, 3,4-Diphenyl-1H-pyrrole-2,5-dicarboxylic acid is notable for its unique structural features and potential utility in both synthetic and medicinal chemistry.
Formula:C18H13NO4
InChI:InChI=1S/C18H13NO4/c20-17(21)15-13(11-7-3-1-4-8-11)14(16(19-15)18(22)23)12-9-5-2-6-10-12/h1-10,19H,(H,20,21)(H,22,23)
InChI key:InChIKey=KEPFKTIMWQZVNN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(=C(C(O)=O)N1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • 3,4-Diphenylpyrrole-2,5-dicarboxylic acid
  • Pyrrole-2,5-dicarboxylic acid, 3,4-diphenyl-
  • 3,4-Diphenyl-1H-pyrrole-2,5-dicarboxylic acid
  • 1H-Pyrrole-2,5-dicarboxylic acid, 3,4-diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.