CAS 1632-68-4

Norborneol

Description:

Norborneol, with the CAS number 1632-68-4, is a bicyclic organic compound that belongs to the class of norbornanes. It is characterized by its unique bicyclic structure, which includes a bridged bicyclic framework derived from norbornene. Norborneol exists in two stereoisomeric forms, with the most common being the endo isomer, which is typically more stable due to steric interactions. This compound is a colorless to pale yellow liquid with a characteristic camphor-like odor. Norborneol is known for its applications in organic synthesis, particularly as a chiral building block in the production of various pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. Additionally, norborneol can undergo various chemical reactions, including oxidation and reduction, making it a versatile intermediate in synthetic chemistry. Its physical and chemical properties, such as boiling point and melting point, are influenced by its molecular structure and stereochemistry, which are crucial for its reactivity and applications in different chemical processes.

Formula: C₇H₁₂O

InChI: InChI=1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2

InChI key: InChIKey=ZQTYQMYDIHMKQB-UHFFFAOYSA-N

SMILES: OC1C2CC(C1)CC2

Synonyms:

• 2-Norbornanol
• 2-Norborneol
• Bicyclo[2.2.1]Heptan-2-Ol
• N-Norborneol = a-Norborneol = 2-Norbornanol
• NSC 22454
• Norborneol
• Norbornyl alcohol

Bicyclo[2.2.1]heptan-2-ol

CAS: 1632-68-4

Formula: C₇H₁₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 112.1696

Ref: IN-DA001TV0

Bicyclo[2.2.1]heptan-2-ol

CAS: 1632-68-4

Bicyclo[2.2.1]heptan-2-ol

Formula: C₇H₁₂O

Purity: 98%

Color and Shape: colourless crystals

Molecular weight: 112.16958g/mol

Ref: 54-OR26341

Bicyclo[2.2.1]heptan-2-ol

CAS: 1632-68-4

Purity: 97%

Molecular weight: 112.1719971

Ref: 10-F639700

bicyclo[2.2.1]heptan-2-ol

CAS: 1632-68-4

Bicyclo[2.2.1]heptan-2-ol is a ternary compound that has been synthesized by the reaction of trifluoroacetic acid with hydrochloric acid and methyl ethyl ketone. This type of polymerization reaction is highly reactive, leading to an increase in kinetic energy and deuterium isotope effects. The steric interactions between the carbonyl group and the olefin double bond are also important in this process.

Formula: C₇H₁₂O

Purity: Min. 95%

Molecular weight: 112.17 g/mol

Ref: 3D-BAA63268