CAS 163217-67-2
:4-Fluoro-α-(2-methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylmethoxy)phenyl]benzenebutanamide
Description:
4-Fluoro-α-(2-methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylmethoxy)phenyl]benzenebutanamide, with CAS number 163217-67-2, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, ketones, and aromatic rings. This compound is likely to exhibit significant lipophilicity due to its extensive aromatic character, which may influence its solubility and bioavailability in biological systems. The presence of the fluorine atom can enhance metabolic stability and alter the compound's pharmacokinetic properties. Additionally, the various substituents on the phenyl rings may contribute to its potential biological activity, making it a candidate for research in medicinal chemistry. Its specific interactions with biological targets would depend on the spatial arrangement of its functional groups, which could affect binding affinity and selectivity. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in the context of targeting specific pathways or receptors in therapeutic contexts.
Formula:C33H30FNO4
InChI:InChI=1S/C33H30FNO4/c1-22(2)31(36)30(29(24-11-7-4-8-12-24)32(37)25-13-15-26(34)16-14-25)33(38)35-27-17-19-28(20-18-27)39-21-23-9-5-3-6-10-23/h3-20,22,29-30H,21H2,1-2H3,(H,35,38)
InChI key:InChIKey=GQGGAQUHBXLZMT-UHFFFAOYSA-N
SMILES:C(C(C(NC1=CC=C(OCC2=CC=CC=C2)C=C1)=O)C(C(C)C)=O)(C(=O)C3=CC=C(F)C=C3)C4=CC=CC=C4
Synonyms:- 4-Methyl-3-oxo-N-(4-benzyloxyphenyl)-2-[1-phenyl-2-(4-fluorophenyl)-2-oxoethyl]pentamide
- 2-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid (4-Benzyloxy-phenyl)-amide
- Benzenebutanamide, 4-fluoro-α-(2-methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylmethoxy)phenyl]-
- 2-[2-(4-Fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxopentanoic acid N-(4-benzyloxyphenyl)amide
- 4-Fluoro-α-(2-methyl-1-oxopropyl)-γ-oxo-β-phenyl-N-[4-(phenylmethoxy)phenyl]benzenebutanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid, (4-Benzyloxy-phenyl)-amide
CAS:Formula:C33H30FNO4Color and Shape:SolidMolecular weight:523.5942-[2-(4-Fluorophenyl)-2-oxo-1-phenyl-ethyl]-4-methyl-3-oxo-pentanoic Acid, (4-Benzyloxy-phenyl)-amide
CAS:Controlled ProductApplications An intermediate of the metabolite of Atorvastin, a selective, competitive HMG-CoA reductase inhibitor. Atorvastin is the only drug in its class specfically indicated for lowering both elevated LDL-cholesterol and triglycerides in patients with hypercholesterolemia.
Formula:C33H30FNO4Color and Shape:NeatMolecular weight:523.59

