CymitQuimica logo

CAS 1632286-04-4

:

3-[[4-[(5-Bromo-2-chlorophenyl)methyl]phenoxy]methyl]-3-fluorooxetane

Description:
3-[[4-[(5-Bromo-2-chlorophenyl)methyl]phenoxy]methyl]-3-fluorooxetane is a synthetic organic compound characterized by its complex molecular structure, which includes an oxetane ring, a phenyl group, and halogen substituents. The presence of a fluorine atom and bromine and chlorine substituents on the aromatic rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit specific interactions with biological targets, making it of interest in pharmaceutical research. Its oxetane structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's solubility, stability, and reactivity can vary based on the functional groups present, and it may undergo various chemical transformations under different conditions. As with many synthetic compounds, safety and handling precautions are essential due to the presence of halogens, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and materials science.
Formula:C17H15BrClFO2
InChI:InChI=1S/C17H15BrClFO2/c18-14-3-6-16(19)13(8-14)7-12-1-4-15(5-2-12)22-11-17(20)9-21-10-17/h1-6,8H,7,9-11H2
InChI key:InChIKey=CXJASDOLOBAUIH-UHFFFAOYSA-N
SMILES:C(C1=CC=C(OCC2(F)COC2)C=C1)C3=C(Cl)C=CC(Br)=C3
Synonyms:
  • Oxetane, 3-[[4-[(5-bromo-2-chlorophenyl)methyl]phenoxy]methyl]-3-fluoro-
  • 3-[[4-[(5-Bromo-2-chlorophenyl)methyl]phenoxy]methyl]-3-fluorooxetane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.