CymitQuimica logo

CAS 1632286-05-5

:

N-(3-Chloro-4-fluorophenyl)-N-(7-fluoro-6-nitro-4-quinazolinyl)acetamide

Description:
N-(3-Chloro-4-fluorophenyl)-N-(7-fluoro-6-nitro-4-quinazolinyl)acetamide is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazoline moiety and multiple halogen substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its specific functional groups. The presence of chlorine and fluorine atoms suggests that it may possess unique electronic properties, influencing its reactivity and interaction with biological targets. The nitro group can enhance the compound's pharmacological profile, potentially contributing to its efficacy in medicinal chemistry. Additionally, the acetamide functional group may play a role in the compound's ability to form hydrogen bonds, affecting its binding affinity to target proteins. Overall, this compound's characteristics make it of interest in pharmaceutical research, particularly in the development of targeted therapies. However, detailed studies would be necessary to fully understand its biological activity and potential applications.
Formula:C16H9ClF2N4O3
InChI:InChI=1S/C16H9ClF2N4O3/c1-8(24)22(9-2-3-12(18)11(17)4-9)16-10-5-15(23(25)26)13(19)6-14(10)20-7-21-16/h2-7H,1H3
InChI key:InChIKey=PRHSJEPACCEZEF-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C=1C2=C(C=C(F)C(N(=O)=O)=C2)N=CN1)C3=CC(Cl)=C(F)C=C3
Synonyms:
  • N-(3-Chloro-4-fluorophenyl)-N-(7-fluoro-6-nitro-4-quinazolinyl)acetamide
  • Acetamide, N-(3-chloro-4-fluorophenyl)-N-(7-fluoro-6-nitro-4-quinazolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.