CymitQuimica logo

CAS 1632286-19-1

:

2,5-Bis(1,1-dimethylethyl) 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate

Description:
2,5-Bis(1,1-dimethylethyl) 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate, identified by its CAS number 1632286-19-1, is a chemical compound characterized by its unique bicyclic structure and the presence of two carboxylate groups. This compound features a bicyclo[2.2.2]octane framework, which contributes to its rigidity and stability. The presence of two 1,1-dimethylethyl groups enhances its steric bulk, potentially influencing its reactivity and solubility in various solvents. The dicarboxylate functional groups suggest that it may participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit interesting properties such as thermal stability and potential applications in organic synthesis or as a ligand in coordination chemistry. Its specific characteristics, including melting point, boiling point, and solubility, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a complex structure with potential utility in various chemical applications.
Formula:C16H28N2O4
InChI:InChI=1S/C16H28N2O4/c1-15(2,3)21-13(19)17-9-12-8-7-11(17)10-18(12)14(20)22-16(4,5)6/h11-12H,7-10H2,1-6H3
InChI key:InChIKey=ABGGQKOQAMWLHU-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2CN(C(OC(C)(C)C)=O)C(C1)CC2
Synonyms:
  • 2,5-Diaza-bicyclo[2.2.2]octane-2,5-dicarboxylic acid di-tert-butyl ester
  • 2,5-Bis(1,1-dimethylethyl) 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate
  • 2,5-Diazabicyclo[2.2.2]octane-2,5-dicarboxylic acid, 2,5-bis(1,1-dimethylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.