
CAS 16323-08-3
:N-(4-Fluoro-2-hydroxyphenyl)acetamide
Description:
N-(4-Fluoro-2-hydroxyphenyl)acetamide, with the CAS number 16323-08-3, is an organic compound characterized by its acetamide functional group attached to a phenolic structure. This compound features a fluorine atom at the para position relative to a hydroxyl group on the aromatic ring, which influences its chemical reactivity and biological activity. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the fluorine atom can enhance lipophilicity and metabolic stability. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring, making it a candidate for further research in drug development and chemical synthesis.
Formula:C8H8FNO2
InChI:InChI=1S/C8H8FNO2/c1-5(11)10-7-3-2-6(9)4-8(7)12/h2-4,12H,1H3,(H,10,11)
InChI key:InChIKey=NDTHRWDAUORQSQ-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(O)C=C(F)C=C1
Synonyms:- 2-Acetamido-5-fluorophenol
- N-(4-Fluoro-2-hydroxyphenyl)acetamide
- Acetanilide, 4′-fluoro-2′-hydroxy-
- Acetamide, N-(4-fluoro-2-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.