CAS 16323-43-6: p-Phenylenediacrylic acid
Description:p-Phenylenediacrylic acid, with the CAS number 16323-43-6, is an organic compound characterized by its structure, which features two acrylic acid groups attached to a p-phenylenediamine backbone. This compound typically appears as a white to light yellow solid and is known for its potential applications in polymer chemistry, particularly in the synthesis of various copolymers and as a crosslinking agent. It exhibits properties such as good thermal stability and the ability to undergo polymerization, making it useful in the production of materials with enhanced mechanical properties. Additionally, p-Phenylenediacrylic acid can participate in various chemical reactions, including radical polymerization, which allows for the formation of diverse polymeric structures. Its solubility can vary depending on the solvent, and it is generally soluble in organic solvents. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, p-Phenylenediacrylic acid is a versatile compound with significant relevance in materials science and organic synthesis.
Formula:C12H10O4
InChI:InChI=1S/C12H10O4/c13-11(14)7-5-9-1-2-10(4-3-9)6-8-12(15)16/h1-8H,(H,13,14)(H,15,16)
InChI key:InChIKey=AAFXQFIGKBLKMC-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC=C(C=CC(=O)O)C=C1
- Synonyms:
- (2'E)-3,3'-benzene-1,4-diylbisprop-2-enoic acid
- (2E,2'E)-3,3'-benzene-1,4-diylbisprop-2-enoate
- (2E,2'E)-3,3'-benzene-1,4-diylbisprop-2-enoic acid
- 1,4-Benzenediacrylic acid
- 1,4-Phenylenediacrylic acid
- 2,2'-Benzene-1,4-Diylbisprop-2-Enoic Acid
- 2-Propenoic acid, 3,3′-(1,4-phenylene)bis-
- 3,3'-Benzene-1,3-Diylbisprop-2-Enoic Acid
- 3,3'-Benzene-1,4-Diylbisprop-2-Enoic Acid
- 3,3′-(1,4-Phenylene)bis[2-propenoic acid]
- See more synonyms
- NSC 133919
- p-Benzenediacrylic acid
- p-Phenylenebis[acrylic acid]
- p-Phenylenediacrylic acid
