CAS 163234-74-0

Pyridine, 2-fluoro-3-methoxy-

Description:

Pyridine, 2-fluoro-3-methoxy- is an organic compound characterized by a pyridine ring substituted with a fluorine atom at the second position and a methoxy group at the third position. This compound belongs to the class of heterocyclic aromatic compounds, which are known for their distinct properties due to the presence of nitrogen in the ring. The fluorine substituent can influence the compound's reactivity and polarity, while the methoxy group can enhance solubility in organic solvents and may participate in various chemical reactions. Pyridine derivatives are often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to their ability to act as ligands and intermediates in chemical reactions. The presence of both electronegative groups (fluorine and oxygen) can also affect the electronic distribution within the molecule, potentially altering its biological activity and interaction with other substances. Overall, 2-fluoro-3-methoxy-pyridine exhibits unique chemical behavior that makes it of interest in various fields of research and application.

Formula: C₆H₆FNO

InChI: InChI=1/C6H6FNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3

SMILES: COc1cccnc1F

Synonyms:

• 2-Fluoro-3-Methoxypyridine

Pyridine, 2-fluoro-3-methoxy-

CAS: 163234-74-0

Formula: C₆H₆FNO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 127.1163

Ref: IN-DA001TXK

2-Fluoro-3-methoxypyridine

CAS: 163234-74-0

Purity: 98%

Molecular weight: 127.116

Ref: FT-Y15200

2-Fluoro-3-methoxypyridine

CAS: 163234-74-0

2-Fluoro-3-methoxypyridine

Formula: C₆H₆FNO

Purity: 98%

Color and Shape: colourless liquid

Molecular weight: 127.12g/mol

Ref: 54-PC908496

2-Fluoro-3-methoxypyridine

CAS: 163234-74-0

Formula: C₆H₆FNO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 127.118

Ref: 10-F217875