CAS 163252-36-6: clevudine
Description:Clevudine is an antiviral nucleoside analog primarily investigated for its potential in treating chronic hepatitis B virus (HBV) infections. It is characterized by its structural similarity to naturally occurring nucleosides, which allows it to interfere with viral replication. Clevudine functions by inhibiting the viral polymerase enzyme, thereby preventing the synthesis of viral DNA. This compound is typically administered orally and has shown promise in clinical trials for its efficacy and safety profile. Its mechanism of action involves selective incorporation into viral DNA, leading to chain termination during replication. Clevudine is notable for its relatively favorable pharmacokinetic properties, including good bioavailability and a manageable half-life. However, like many antiviral agents, it may be associated with side effects, and resistance can develop with prolonged use. Ongoing research continues to evaluate its long-term effectiveness and potential role in combination therapies for HBV. Overall, clevudine represents a significant advancement in the pharmacological arsenal against hepatitis B.
Formula:C10H13FN2O5
InChI:InChI=1S/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7-,9-/m0/s1
InChI key:InChIKey=GBBJCSTXCAQSSJ-XQXXSGGOSA-N
SMILES:O=C1NC(=O)N(C=C1C)C2OC(CO)C(O)C2F
- Synonyms:
- 1-(2-Deoxy-2-fluoro-b-L-arabinofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione
- 1-(2-Deoxy-2-fluoro-beta-L-arabinofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
- 1-(2-Deoxy-2-fluoro-β-<span class="text-smallcaps">L</span>-arabinofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione
- 1-(2′-Deoxy-2′-fluoro-β-<span class="text-smallcaps">L</span>-arabinofuranosyl)-5-methyluracil
- 2'-Fluoro-5-methyl-b-L-arabinofuranosyluracil
- 2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-β-<span class="text-smallcaps">L</span>-arabinofuranosyl)-5-methyl-
- 2,4(1H,3H)-pyrimidinedione, 1-(2-deoxy-2-fluoro-beta-L-arabinofuranosyl)-5-methyl-
- L-Fmau
- Levovir
- Clevudine
- See more synonyms
- 2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-β-L-arabinofuranosyl)-5-methyl-
- 1-(2′-Deoxy-2′-fluoro-β-L-arabinofuranosyl)-5-methyluracil
