CAS 16328-63-5

2H-IMIDAZO[4,5-B]PYRAZIN-2-ONE, 1,3-DIHYDRO-

Description:

2H-Imidazo[4,5-b]pyrazin-2-one, 1,3-dihydro- is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings. This compound features a nitrogen-containing bicyclic structure, which contributes to its potential biological activity. Typically, such compounds exhibit properties that may include antimicrobial, antiviral, or anticancer activities, making them of interest in medicinal chemistry. The presence of the 1,3-dihydro configuration indicates that the compound may exist in a partially saturated form, which can influence its reactivity and interaction with biological targets. Additionally, the molecular structure allows for various functionalization possibilities, which can enhance its pharmacological properties. The compound is likely to be soluble in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 2H-imidazo[4,5-b]pyrazin-2-one, 1,3-dihydro- represents a class of compounds that are valuable in research and development for therapeutic applications.

Formula: C₅H₄N₄O

InChI: InChI=1/C5H4N4O/c10-5-8-3-4(9-5)7-2-1-6-3/h1-2H,(H2,6,7,8,9,10)

SMILES: c1c[nH]c2c(n1)nc(n2)O

Synonyms:

• 1,3-Dihydro-2H-imidazo[4,5-b]pyrazin-2-one

2H-IMIDAZO[4,5-B]PYRAZIN-2-ONE, 1,3-DIHYDRO-

CAS: 16328-63-5

Formula: C₅H₄N₄O

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.1115

Ref: IN-DA001TZR

1,3-Dihydro-2H-imidazo[4,5-b]pyrazin-2-one

CAS: 16328-63-5

1,3-Dihydro-2H-imidazo[4,5-b]pyrazin-2-one

Purity: 97%

Ref: 54-OR1042166

1,3-Dihydro-2H-imidazo[4,5-b]pyrazin-2-one

CAS: 16328-63-5

Formula: C₅H₄N₄O

Purity: 97%

Molecular weight: 136.114

Ref: 10-F430630