CAS 163295-70-3
:(3,5-Dichlorophenyl)methanesulfonyl chloride
Description:
(3,5-Dichlorophenyl)methanesulfonyl chloride, with the CAS number 163295-70-3, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a dichlorophenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonyl groups into various substrates. The presence of chlorine atoms on the phenyl ring enhances its electrophilic character, allowing it to engage in further chemical transformations. Additionally, this compound is generally handled with caution due to its potential to release toxic gases upon hydrolysis and its corrosive nature. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance in a laboratory setting.
Formula:C7H5Cl3O2S
InChI:InChI=1S/C7H5Cl3O2S/c8-6-1-5(2-7(9)3-6)4-13(10,11)12/h1-3H,4H2
InChI key:InChIKey=GZMJRPMBVICCFL-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C1=CC(Cl)=CC(Cl)=C1
Synonyms:- (3,5-Dichlorophenyl)Methylsulphonyl Chloride
- (3,5-Dichlorophenyl)methanesulfonyl chloride
- 3,5-Dichloro-��-toluenesufonyl chloride
- 3,5-Dichlorobenzenemethanesulfonyl chloride
- Benzenemethanesulfonyl chloride, 3,5-dichloro-
- [(3,5-Dichlorophenyl)Methyl]Sulfonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Dichloro-α-toluenesulfonyl chloride, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H5Cl3O2SPurity:96%Molecular weight:259.54Benzenemethanesulfonyl chloride, 3,5-dichloro-
CAS:Formula:C7H5Cl3O2SPurity:97%Color and Shape:SolidMolecular weight:259.5374(3,5-Dichlorophenyl)methanesulphonyl chloride
CAS:<p>(3,5-Dichlorophenyl)methanesulphonyl chloride</p>Formula:C7H5Cl3O2SPurity:97%Color and Shape: white crystalline powderMolecular weight:259.54g/mol[(3,5-DICHLOROPHENYL)METHYL]SULFONYL CHLORIDE
CAS:Formula:C7H5Cl3O2SPurity:95.0%Molecular weight:259.53(3,5-Dichlorophenyl)methanesulfonyl chloride
CAS:<p>Please enquire for more information about (3,5-Dichlorophenyl)methanesulfonyl chloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C7H5Cl3O2SPurity:Min. 95%Molecular weight:259.54 g/mol




