CAS 1633-00-7
:Hexamethylenediaminetetraacetic acid
Description:
Hexamethylenediaminetetraacetic acid (HMDTA) is a chelating agent characterized by its ability to form stable complexes with metal ions. It features a hexamethylene backbone with four carboxylic acid groups, which enhances its chelating properties. HMDTA is typically used in various applications, including analytical chemistry, water treatment, and as a stabilizer in formulations. The compound is soluble in water, making it effective in aqueous environments. Its chelation capacity allows it to sequester metal ions, preventing precipitation and enhancing the solubility of metal complexes. HMDTA is also recognized for its low toxicity and environmental compatibility, making it a preferable choice over other chelating agents in certain applications. Additionally, it can be utilized in biological systems for its potential to modulate metal ion availability, which is crucial in biochemical processes. Overall, HMDTA is valued for its multifunctional properties and versatility in both industrial and research settings.
Formula:C14H24N2O8
InChI:InChI=1S/C14H24N2O8/c17-11(18)7-15(8-12(19)20)5-3-1-2-4-6-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChI key:InChIKey=YGDVXSDNEFDTGV-UHFFFAOYSA-N
SMILES:N(CCCCCCN(CC(O)=O)CC(O)=O)(CC(O)=O)CC(O)=O
Synonyms:- 1,6-Hexamethylenediamine-N,N,N′,N′-tetraacetic acid
- 1,6-Hexanediamine-N,N,N′,N′-tetraacetic acid
- 2,2',2'',2'''-(Hexane-1,6-Diyldinitrilo)Tetraacetic Acid
- 2-([6-[Bis(carboxymethyl)amino]hexyl](carboxymethyl)amino)acetic acid
- Acetic acid, (hexamethylenedinitrilo)tetra-
- Glycine, N,N′-1,6-hexanediylbis[N-(carboxymethyl)-
- Hexamethylenediaminetetraacetic acid
- N,N′-1,6-Hexanediylbis[N-(carboxymethyl)glycine]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Glycine, N,N'-1,6-hexanediylbis[N-(carboxymethyl)-
CAS:Formula:C14H24N2O8Purity:98%Color and Shape:SolidMolecular weight:348.34901,6-Diaminohexane-N,N,N',N'-Tetraacetic Acid
CAS:1,6-Diaminohexane-N,N,N',N'-Tetraacetic AcidPurity:≥98%Molecular weight:348.35g/mol1,6-Diaminohexane-N,N,N',N'-tetraacetic Acid
CAS:Formula:C14H24N2O8Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:348.351,6-Diaminohexane-N,N,N²,N²-tetraacetic acid
CAS:1,6-Diaminohexane-N,N,N²,N²-tetraacetic acid (DAHA) is a metal chelator that binds to the metal ions of copper and nickel. It has minimal toxicity and is used to prepare biological samples for analysis. DAHA binds to metal ions in the presence of glycol ethers or fatty acids. This complex is then separated by particle size using a centrifuge or liquid chromatography. DAHA can be used as an antimicrobial agent against bacteria such as Staphylococcus aureus and Pseudomonas aeruginosa.Formula:C14H24N2O8Purity:Min. 95%Molecular weight:348.35 g/mol



