CAS 1633-43-8

4-Ethoxy-3-pyridinamine

Description:

4-Ethoxy-3-pyridinamine, with the CAS number 1633-43-8, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethoxy group (-OCH2CH3) and an amino group (-NH2) attached to the pyridine ring, specifically at the 4 and 3 positions, respectively. The presence of these functional groups contributes to its solubility in polar solvents and its potential reactivity in various chemical reactions, such as nucleophilic substitutions. 4-Ethoxy-3-pyridinamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for hydrogen bonding, which can influence its interactions with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on its purity and the conditions under which it is studied. Overall, 4-Ethoxy-3-pyridinamine is a compound of interest due to its structural features and potential applications in various fields of chemistry and pharmacology.

Formula: C₇H₁₀N₂O

InChI: InChI=1S/C7H10N2O/c1-2-10-7-3-4-9-5-6(7)8/h3-5H,2,8H2,1H3

InChI key: InChIKey=XHEMFRKTOJUJJX-UHFFFAOYSA-N

SMILES: O(CC)C=1C(N)=CN=CC1

Synonyms:

• (4-Ethoxypyridin-3-yl)amine
• 3-Pyridinamine, 4-ethoxy-
• 4-Ethoxy-3-Aminopyridine
• 4-Ethoxy-3-pyridinamine
• 4-Ethoxypyridin-3-Amine
• 6-Ethoxypyridin-3-Amine
• Pyridine, 3-amino-4-ethoxy-
• 3-Amino-4-ethoxypyridine

3-Pyridinamine, 4-ethoxy-

CAS: 1633-43-8

Formula: C₇H₁₀N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.1671

Ref: IN-DA001U0G

3-Amino-4-ethoxypyridine

CAS: 1633-43-8

3-Amino-4-ethoxypyridine

Purity: 97%

Molecular weight: 138.17g/mol

Ref: 54-OR345032

3-Amino-4-ethoxypyridine

CAS: 1633-43-8

Formula: C₇H₁₀N₂O

Purity: 97%

Color and Shape: Solid, Crystalline

Molecular weight: 138.17

Ref: 10-F064874