CAS 16335-07-2

2-aminoquinoline-4-carboxamide

Description:

2-Aminoquinoline-4-carboxamide is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the quinoline ring, specifically at the 2 and 4 positions, respectively. It is typically a crystalline solid that may exhibit moderate solubility in polar solvents due to the presence of the carboxamide functional group. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anticancer properties. Its molecular structure allows for hydrogen bonding, which can influence its reactivity and interactions with biological targets. Additionally, 2-aminoquinoline-4-carboxamide may undergo various chemical reactions, including acylation and alkylation, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₉N₃O

InChI: InChI=1/C10H9N3O/c11-9-5-7(10(12)14)6-3-1-2-4-8(6)13-9/h1-5H,(H2,11,13)(H2,12,14)

SMILES: c1ccc2c(c1)c(cc(=N)[nH]2)C(=N)O

2-Aminoquinoline-4-carboxamide

CAS: 16335-07-2

Formula: C₁₀H₉N₃O

Molecular weight: 187.1980

Ref: IN-DA001U1P

2-Aminoquinoline-4-carboxamide

CAS: 16335-07-2

2-Aminoquinoline-4-carboxamide is a medicament that is used in the treatment of fibrosis and inflammatory disorders. It has been combined with other medicaments to treat fibrotic diseases and inflammatory disorders. 2-Aminoquinoline-4-carboxamide may be used for prophylaxis and/or treatment of fibrotic diseases and inflammatory disorders.

Formula: C₁₀H₉N₃O

Purity: Min. 95%

Molecular weight: 187.2 g/mol

Ref: 3D-RAA33507