CAS 16338-48-0
:(S)-(-)-2-Amino-4-pentenoic acid
Description:
(S)-(-)-2-Amino-4-pentenoic acid, also known as L-2-amino-4-pentenoic acid, is an amino acid characterized by its unique structure that includes a pentenoic acid side chain. It features a chiral center, which contributes to its specific stereochemistry, denoted by the (S) configuration. This compound is a derivative of the amino acid proline and is notable for its role in various biochemical processes. It is typically a white to off-white crystalline solid and is soluble in water, making it suitable for various applications in biochemical research and synthesis. The presence of both an amino group and a carboxylic acid group allows it to participate in peptide bond formation, which is essential for protein synthesis. Additionally, its unsaturated side chain may impart unique reactivity and properties compared to other amino acids. As a compound with potential biological significance, it may be studied for its role in metabolic pathways or as a building block in the synthesis of more complex molecules.
Formula:C5H9NO2
InChI:InChI=1/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m0/s1
SMILES:C=CC[C@@H](C(=O)O)N
Synonyms:- Rarechem Bk Pt 0249
- 3-Vinyl-L-Alanine
- L-C-Allylglycine
- L-Alpha-Allyl-Gly
- L-Alpha-Allyl-Glycine
- H-(Allyl)Gly-Oh
- (2S)-2-Aminopent-4-Enoic Acid
- H-Gly(Allyl)-Oh
- L-Allylglycine
- (S)-2-Aminopent-4-enoic acid
- L-2-Amino-4-pentenoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Pentenoic acid, 2-amino-, (2S)-
CAS:Formula:C5H9NO2Purity:97%Color and Shape:SolidMolecular weight:115.1305Ref: IN-DA001U2F
1g26.00€5g60.00€10g95.00€1kgTo inquire25g182.00€100g685.00€500gTo inquire250mg25.00€2-Allyl-L-glycine
CAS:2-Allyl-L-glycineFormula:C5H9NO2Purity:≥95%Color and Shape: white solidMolecular weight:115.13g/mol(S)-(-)-2-Amino-4-pentenoic acid
CAS:Formula:C5H9NO2Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:115.13L-Allylglycine
CAS:<p>L-Allylglycine is a potent inhibitor of the synthetic enzyme for GABA, glutamic acid decarboxylase.</p>Formula:C5H9NO2Purity:≥98%Color and Shape:White To Off-White Crystalline PowderMolecular weight:115.13L-Allylglycine
CAS:Controlled Product<p>Applications L-Allylglycine is a glutamic acid decarboxylase inhibitor.<br>References BBrandao, M., et al.: Pharmacol. Biochem. Behav., 24, 497 (1986); Orlowski, M., et al.: J. Neurochem., 28, 349 (1977)<br></p>Formula:C5H9NO2Color and Shape:NeatMolecular weight:115.13L-Allylglycine
CAS:<p>L-Allylglycine is an antimicrobial agent that inhibits the growth of bacteria by binding to the glutamate receptor. L-Allylglycine has been shown to inhibit the locomotor activity in rats, which may be due to its ability to bind with the serotonergic system and dopamine receptors. L-Allylglycine also binds to Toll-like receptor 4, a protein found on macrophages and microglia in the brain, which may contribute to its neuroprotective effects. It has been shown that L-allylglycine can inhibit a glutamate receptor in mitochondria, which is responsible for the production of ATP. This inhibition prevents DNA replication and cell division, leading to cell death. The asymmetric synthesis of this molecule allows it to have a greater affinity for bacterial cells than mammalian cells.</p>Formula:C5H9NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:115.13 g/mol(S)-2-Amino-4-pentenoic acid
CAS:Formula:C5H9NO2Purity:95%Color and Shape:Solid, CrystallineMolecular weight:115.132
