
CAS 16338-99-1
:N-Methyl-N-nitroso-1-heptanamine
Description:
N-Methyl-N-nitroso-1-heptanamine, with the CAS number 16338-99-1, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This substance features a heptanamine backbone, indicating it has a seven-carbon chain, with a methyl group and a nitroso group attached to the nitrogen atom. The presence of the nitroso group is significant as it can influence the compound's reactivity and stability. Typically, nitrosamines are formed through the reaction of secondary amines with nitrous acid, and they can undergo various chemical transformations, including dealkylation and oxidation. N-Methyl-N-nitroso-1-heptanamine may be of interest in research contexts, particularly in studies related to toxicology and environmental chemistry, due to its potential health implications. However, specific data regarding its physical properties, such as boiling point, melting point, and solubility, may not be widely available, necessitating caution in handling and usage.
Formula:C8H18N2O
InChI:InChI=1S/C8H18N2O/c1-3-4-5-6-7-8-10(2)9-11/h3-8H2,1-2H3
InChI key:InChIKey=REAKWIQVJUHNOX-UHFFFAOYSA-N
SMILES:C(CN(N=O)C)CCCCC
Synonyms:- 1-Heptanamine, N-methyl-N-nitroso-
- N-Methyl-N-nitroso-1-heptanamine
- Heptylamine, N-methyl-N-nitroso-
- Nitrosomethylheptylamine
- N-Nitrosomethyl-n-heptylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

