CAS 1634-34-0
:4-acetyl-3,5-dihydroxytoluene
Description:
4-Acetyl-3,5-dihydroxytoluene, with the CAS number 1634-34-0, is an organic compound that belongs to the class of phenolic compounds. It features a toluene backbone substituted with two hydroxyl groups and an acetyl group, which contributes to its reactivity and potential applications. This compound typically appears as a solid at room temperature and is characterized by its ability to participate in various chemical reactions, including oxidation and esterification. The presence of hydroxyl groups makes it a potential antioxidant, and its acetyl group can influence its solubility and reactivity. 4-Acetyl-3,5-dihydroxytoluene may be utilized in the synthesis of other organic compounds and could have applications in pharmaceuticals, cosmetics, or as a chemical intermediate. Its properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines to ensure safe usage in laboratory or industrial settings.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-5-3-7(11)9(6(2)10)8(12)4-5/h3-4,11-12H,1-2H3
SMILES:Cc1cc(c(C(=O)C)c(c1)O)O
Synonyms:- 1-(2,6-Dihydroxy-4-Methylphenyl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-(2,6-dihydroxy-4-methylphenyl)-
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.17393,5-Dihydroxy-4-acetyltoluene
CAS:3,5-Dihydroxy-4-acetyltoluenePurity:98%Molecular weight:166.17g/mol3,5-Dihydroxy-4-acetyltoluene
CAS:3,5-Dihydroxy-4-acetyltoluene is a versatile building block that is used in the production of various pharmaceutical and agrochemical intermediates. It can be used as a reagent for organic synthesis and as a speciality chemical. 3,5-Dihydroxy-4-acetyltoluene has been shown to have high quality and utility. This compound can also be used as a reaction component or scaffold.
Formula:C9H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:166.17 g/mol1-(2,6-Dihydroxy-4-methylphenyl)ethanone
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.176



