CAS 1634-89-5

Z-Glu-Gly-OH

Description:

Z-Glu-Gly-OH, also known as Z-glutamylglycine, is a dipeptide derivative characterized by the presence of a glutamic acid residue and a glycine residue. The "Z" prefix indicates that the glutamic acid is protected by a benzyloxycarbonyl (Z) group, which is commonly used in peptide synthesis to prevent unwanted reactions during the formation of peptide bonds. This compound is typically utilized in biochemical research and peptide synthesis due to its role in studying peptide interactions and enzymatic processes. Z-Glu-Gly-OH is soluble in polar solvents, such as water and methanol, and exhibits properties typical of peptides, including the ability to form hydrogen bonds and participate in various biochemical reactions. Its structure allows for potential applications in drug development and as a building block for more complex peptides. As with many peptides, stability can be influenced by factors such as pH and temperature, making careful handling and storage essential for maintaining its integrity.

Formula: C₁₅H₁₈N₂O₇

InChI: InChI=1/C15H18N2O7/c18-12(19)7-6-11(14(22)16-8-13(20)21)17-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,22)(H,17,23)(H,18,19)(H,20,21)

SMILES: c1ccc(cc1)COC(=NC(CCC(=O)O)C(=NCC(=O)O)O)O

Synonyms:

• N-[(benzyloxy)carbonyl]-alpha-glutamylglycine

Z-Glu-Gly-OH

CAS: 1634-89-5

Bachem ID: 4003632.

Formula: C₁₅H₁₈N₂O₇

Purity: > 99%

Color and Shape: White Powder

Molecular weight: 338.32

Ref: 01-4003632

(S)-4-(((Benzyloxy)carbonyl)amino)-5-((carboxymethyl)amino)-5-oxopentanoic acid

CAS: 1634-89-5

(S)-4-(((Benzyloxy)carbonyl)amino)-5-((carboxymethyl)amino)-5-oxopentanoic acid

Purity: 98%

Molecular weight: 338.32g/mol

Ref: 54-OR1059603

Cbz-Glu-Gly-OH

CAS: 1634-89-5

Formula: C₁₅H₁₈N₂O₇

Purity: 98%

Molecular weight: 338.316

Ref: 10-F436565

Z-Glu-Gly-OH

CAS: 1634-89-5

Z-Glu-Gly-OH is a cysteine donor for the chemical cross-linking of keratin proteins. Follicle cells are a major source of keratin, and glutamic acid is the most abundant amino acid in these cells. Glutamine is also abundant in keratins, and may be responsible for the cornified layer. Cysteine is used to cross-link the structural proteins, while glutamic acid and glutamine are involved in cross-linking the fibre and residue. Cross-linking results in an insoluble protein matrix that provides strength to skin.

Formula: C₁₅H₁₈N₂O₇

Purity: Min. 95%

Molecular weight: 338.31 g/mol

Ref: 3D-FG111460