CAS 16348-04-2
:1-(4-Methylphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
1-(4-Methylphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione, also known by its CAS number 16348-04-2, is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methylphenyl group at the 1-position, contributing to its aromatic properties. The presence of three carbonyl groups at positions 2, 4, and 6 of the pyrimidine ring classifies it as a pyrimidinetrione, indicating its potential reactivity and ability to participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The methyl group on the phenyl ring can influence the compound's solubility and reactivity, making it of interest in medicinal chemistry and organic synthesis. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential applications in pharmaceuticals or agrochemicals. Its structural features suggest that it could serve as a versatile building block in organic synthesis.
Formula:C11H10N2O3
InChI:InChI=1S/C11H10N2O3/c1-7-2-4-8(5-3-7)13-10(15)6-9(14)12-11(13)16/h2-5H,6H2,1H3,(H,12,14,16)
InChI key:InChIKey=WLGYFVCNEFNYKO-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)NC(=O)C1)C2=CC=C(C)C=C2
Synonyms:- 1-(4-Methylphenyl)-1,3-diazinane-2,4,6-trione
- 1-(4-Methylphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
- 1-p-Tolylpyrimidine-2,4,6-trione
- 2,4,6(1H,3H,5H)-pyrimidinetrione, 1-(4-methylphenyl)-
- Barbituric acid, 1-p-tolyl-
- N-(4-Methylphenyl)barbituric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(4-Toyl)barbituric Acid
CAS:Controlled ProductApplications 1-p-Tolyl-pyrimidine-2,4,6-trione (cas# 16348-04-2) is a useful research chemical.
Formula:C11H10N2O3Color and Shape:NeatMolecular weight:218.209
