CAS 16348-49-5
:2-Aminobenzamidoxime
Description:
2-Aminobenzamidoxime, with the CAS number 16348-49-5, is an organic compound characterized by the presence of both an amino group and an amidoxime functional group attached to a benzene ring. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as a reagent in organic synthesis. The structure features a benzene ring substituted with an amino group (-NH2) and an amidoxime group (-C(=NOH)NH2), which contributes to its reactivity and ability to form various derivatives. 2-Aminobenzamidoxime may exhibit properties such as solubility in polar solvents, and its reactivity can be influenced by the presence of the functional groups, allowing for potential interactions in biological systems or with other chemical species. Additionally, it may possess biological activity, making it of interest in pharmaceutical research. As with many organic compounds, safety data should be consulted for handling and usage, as well as any potential environmental impacts.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c8-6-4-2-1-3-5(6)7(9)10-11/h1-4,11H,8H2,(H2,9,10)
SMILES:c1ccc(c(c1)C(=N)NO)N
Synonyms:- 2-Amino-N'-hydroxybenzenecarboximidamide
- Benzenecarboximidamide, 2-amino-N'-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Aminobenzamidoxime, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H9N3OPurity:97%Molecular weight:151.17Benzenecarboximidamide, 2-amino-N-hydroxy-
CAS:Formula:C7H9N3OPurity:97%Color and Shape:SolidMolecular weight:151.16592-Aminobenzamidoxime
CAS:<p>2-Aminobenzamidoxime is a hydrogen bond donor that can regulate the interaction between two molecules, including proteins and nucleic acids. This chemical can also be used to boost the activity of an acceptor molecule. It is used in pharmacodynamics to introduce fluorescent groups into drugs or other compounds for detection. 2-Aminobenzamidoxime has been shown to possess fluorescence properties and cyclic behavior, which makes it useful for glycan studies. The affinity of 2-aminobenzamidoxime for glycans is due to its nature as a glycosylating agent.</p>Formula:C7H9N3OPurity:Min. 95%Molecular weight:151.17 g/mol




