
CAS 16352-06-0
:2-Amino-4-hydroxy-6-methyl-1,3,5-triazine
Description:
2-Amino-4-hydroxy-6-methyl-1,3,5-triazine, also known as atrazine, is a chemical compound belonging to the triazine family. It is characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms, with various functional groups attached. This compound is typically a white crystalline solid and is soluble in water, making it useful in various applications. It exhibits herbicidal properties, primarily used in agriculture for weed control in crops such as corn and sugarcane. The presence of amino and hydroxy groups contributes to its reactivity and interaction with biological systems. Additionally, 2-amino-4-hydroxy-6-methyl-1,3,5-triazine has been studied for its environmental impact, as it can persist in soil and water, leading to concerns regarding its potential effects on ecosystems and human health. Its use is regulated in many countries due to these environmental considerations. Overall, this compound plays a significant role in agricultural chemistry while also raising important ecological and safety discussions.
Formula:C4H6N4O
InChI:InChI=1/C4H6N4O/c1-2-6-3(5)8-4(9)7-2/h1H3,(H3,5,6,7,8,9)
SMILES:Cc1nc(=N)[nH]c(n1)O
Synonyms:- 4-Amino-6-methyl-1,3,5-triazin-2(1H)-one
- 4-Amino-6-methyl-1,3,5-triazin-2-ol
- 4-amino-6-methyl-1,3,5-triazin-2(5H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1,3,5-Triazin-2(1H)-one, 6-amino-4-methyl-
CAS:Formula:C4H6N4OPurity:97%Color and Shape:SolidMolecular weight:126.11664-Amino-6-methyl-1,3,5-triazin-2-ol
CAS:Controlled ProductFormula:C4H6N4OColor and Shape:NeatMolecular weight:126.122-Amino-4-hydroxy-6-methyl-1,3,5-triazine
CAS:<p>2-Amino-4-hydroxy-6-methyl-1,3,5-triazine</p>Formula:C4H6N4OPurity:95%Color and Shape: white to off-white solidMolecular weight:126.12g/molAcetoguanide
CAS:Controlled Product<p>Applications Acetoguanide is a degradation product of the sulfonylurea herbicide Iodosulfuron.<br>References Pramauro, E., et al.: Environ. Sci. Technol., 27, 1790 (1993); Rouchard, J., et al.: Toxicol. Environ. Chem., 85, 103 (2003); Brigante, M., et al.: J. Agric. Food Chem., 53, 5347 (2005);<br></p>Formula:C4H6N4OColor and Shape:White To Light YellowMolecular weight:126.124-Amino-6-methyl-1,3,5-triazin-2-ol
CAS:Formula:C4H6N4OPurity:95%Color and Shape:SolidMolecular weight:126.119






